C12H18N2O4 — CID 65332440
3-methyl-4-[3-(oxan-3-yl)-1,2,4-oxadiazol-5-yl]butanoic acid (PubChem CID 65332440) has the molecular formula C12H18N2O4 and a molecular weight of 254.29 g/mol. Its IUPAC name is 3-methyl-4-[3-(oxan-3-yl)-1,2,4-oxadiazol-5-yl]butanoic acid.
| Compound Name | 3-methyl-4-[3-(oxan-3-yl)-1,2,4-oxadiazol-5-yl]butanoic acid |
|---|---|
| PubChem CID | 65332440 |
| Molecular Formula | C12H18N2O4 |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | 3-methyl-4-[3-(oxan-3-yl)-1,2,4-oxadiazol-5-yl]butanoic acid |
| SMILES | CC(CC(=O)O)Cc1nc(C2CCCOC2)no1 |
| InChI | InChI=1S/C12H18N2O4/c1-8(6-11(15)16)5-10-13-12(14-18-10)9-3-2-4-17-7-9/h8-9H,2-7H2,1H3,(H,15,16) |
| InChIKey | VOQJHPJESWIICA-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 85.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |