C13H14FNO — CID 65332564
6-fluoro-8-methyl-2,3,4,9-tetrahydro-1H-carbazol-3-ol (PubChem CID 65332564) has the molecular formula C13H14FNO and a molecular weight of 219.26 g/mol. Its IUPAC name is 6-fluoro-8-methyl-2,3,4,9-tetrahydro-1H-carbazol-3-ol.
| Compound Name | 6-fluoro-8-methyl-2,3,4,9-tetrahydro-1H-carbazol-3-ol |
|---|---|
| PubChem CID | 65332564 |
| Molecular Formula | C13H14FNO |
| Molecular Weight | 219.26 g/mol |
| Exact Mass | 219.11 |
| IUPAC Name | 6-fluoro-8-methyl-2,3,4,9-tetrahydro-1H-carbazol-3-ol |
| SMILES | Cc1cc(F)cc2c3c([nH]c12)CCC(O)C3 |
| InChI | InChI=1S/C13H14FNO/c1-7-4-8(14)5-11-10-6-9(16)2-3-12(10)15-13(7)11/h4-5,9,15-16H,2-3,6H2,1H3 |
| InChIKey | LVHOAIRLKIZXED-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 36.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.26 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|