C14H16Cl2N2 — CID 65332641
6,8-dichloro-N-ethyl-2,3,4,9-tetrahydro-1H-carbazol-1-amine (PubChem CID 65332641) has the molecular formula C14H16Cl2N2 and a molecular weight of 283.20 g/mol. Its IUPAC name is 6,8-dichloro-N-ethyl-2,3,4,9-tetrahydro-1H-carbazol-1-amine.
| Compound Name | 6,8-dichloro-N-ethyl-2,3,4,9-tetrahydro-1H-carbazol-1-amine |
|---|---|
| PubChem CID | 65332641 |
| Molecular Formula | C14H16Cl2N2 |
| Molecular Weight | 283.20 g/mol |
| Exact Mass | 282.07 |
| IUPAC Name | 6,8-dichloro-N-ethyl-2,3,4,9-tetrahydro-1H-carbazol-1-amine |
| SMILES | CCNC1CCCc2c1[nH]c1c(Cl)cc(Cl)cc21 |
| InChI | InChI=1S/C14H16Cl2N2/c1-2-17-12-5-3-4-9-10-6-8(15)7-11(16)13(10)18-14(9)12/h6-7,12,17-18H,2-5H2,1H3 |
| InChIKey | HIKLTSPLLMKGMK-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.20 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|