About 1-(4,5,7-trifluoro-2-methyl-1H-indol-3-yl)ethanol
1-(4,5,7-trifluoro-2-methyl-1H-indol-3-yl)ethanol (PubChem CID 65332721) has the molecular formula C11H10F3NO
and a molecular weight of 229.20 g/mol. Its IUPAC name is 1-(4,5,7-trifluoro-2-methyl-1H-indol-3-yl)ethanol.
Molecular Properties
| Compound Name | 1-(4,5,7-trifluoro-2-methyl-1H-indol-3-yl)ethanol |
| PubChem CID | 65332721 |
| Molecular Formula | C11H10F3NO |
| Molecular Weight | 229.20 g/mol |
| Exact Mass | 229.07 |
| IUPAC Name | 1-(4,5,7-trifluoro-2-methyl-1H-indol-3-yl)ethanol |
| SMILES | Cc1[nH]c2c(F)cc(F)c(F)c2c1C(C)O |
| InChI | InChI=1S/C11H10F3NO/c1-4-8(5(2)16)9-10(14)6(12)3-7(13)11(9)15-4/h3,5,15-16H,1-2H3 |
| InChIKey | XSZUJNUIMHKGNZ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 36.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.20 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 1-(4,5,7-trifluoro-2-methyl-1H-indol-3-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4,5,7-trifluoro-2-methyl-1H-indol-3-yl)ethanol?
The IUPAC name of 1-(4,5,7-trifluoro-2-methyl-1H-indol-3-yl)ethanol (CID 65332721) is 1-(4,5,7-trifluoro-2-methyl-1H-indol-3-yl)ethanol.
What is the SMILES notation for 1-(4,5,7-trifluoro-2-methyl-1H-indol-3-yl)ethanol?
The canonical SMILES for 1-(4,5,7-trifluoro-2-methyl-1H-indol-3-yl)ethanol is Cc1[nH]c2c(F)cc(F)c(F)c2c1C(C)O.
What is the InChIKey of 1-(4,5,7-trifluoro-2-methyl-1H-indol-3-yl)ethanol?
The InChIKey is XSZUJNUIMHKGNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10F3NO/c1-4-8(5(2)16)9-10(14)6(12)3-7(13)11(9)15-4/h3,5,15-16H,1-2H3.
What are the key properties of 1-(4,5,7-trifluoro-2-methyl-1H-indol-3-yl)ethanol?
1-(4,5,7-trifluoro-2-methyl-1H-indol-3-yl)ethanol has a molecular weight of 229.20 g/mol, XLogP of 2.95, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4,5,7-trifluoro-2-methyl-1H-indol-3-yl)ethanol is sourced from PubChem (CID 65332721), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).