C16H21NO — CID 65332947
2,2,5,7-tetramethyl-1,3,4,9-tetrahydrocarbazol-4-ol (PubChem CID 65332947) has the molecular formula C16H21NO and a molecular weight of 243.35 g/mol. Its IUPAC name is 2,2,5,7-tetramethyl-1,3,4,9-tetrahydrocarbazol-4-ol.
| Compound Name | 2,2,5,7-tetramethyl-1,3,4,9-tetrahydrocarbazol-4-ol |
|---|---|
| PubChem CID | 65332947 |
| Molecular Formula | C16H21NO |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.16 |
| IUPAC Name | 2,2,5,7-tetramethyl-1,3,4,9-tetrahydrocarbazol-4-ol |
| SMILES | Cc1cc(C)c2c3c([nH]c2c1)CC(C)(C)CC3O |
| InChI | InChI=1S/C16H21NO/c1-9-5-10(2)14-11(6-9)17-12-7-16(3,4)8-13(18)15(12)14/h5-6,13,17-18H,7-8H2,1-4H3 |
| InChIKey | CYBSYIJUFLLTAB-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 36.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |