C11H11FN2 — CID 65333031
5-fluoro-1,2,3,4-tetrahydrocyclopenta[b]indol-1-amine (PubChem CID 65333031) has the molecular formula C11H11FN2 and a molecular weight of 190.22 g/mol. Its IUPAC name is 5-fluoro-1,2,3,4-tetrahydrocyclopenta[b]indol-1-amine.
| Compound Name | 5-fluoro-1,2,3,4-tetrahydrocyclopenta[b]indol-1-amine |
|---|---|
| PubChem CID | 65333031 |
| Molecular Formula | C11H11FN2 |
| Molecular Weight | 190.22 g/mol |
| Exact Mass | 190.09 |
| IUPAC Name | 5-fluoro-1,2,3,4-tetrahydrocyclopenta[b]indol-1-amine |
| SMILES | NC1CCc2[nH]c3c(F)cccc3c21 |
| InChI | InChI=1S/C11H11FN2/c12-7-3-1-2-6-10-8(13)4-5-9(10)14-11(6)7/h1-3,8,14H,4-5,13H2 |
| InChIKey | CNLSEXIAEFKIJQ-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 41.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.22 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|