C15H19FN2 — CID 65333102
N-ethyl-6-fluoro-8-methyl-2,3,4,9-tetrahydro-1H-carbazol-1-amine (PubChem CID 65333102) has the molecular formula C15H19FN2 and a molecular weight of 246.33 g/mol. Its IUPAC name is N-ethyl-6-fluoro-8-methyl-2,3,4,9-tetrahydro-1H-carbazol-1-amine.
| Compound Name | N-ethyl-6-fluoro-8-methyl-2,3,4,9-tetrahydro-1H-carbazol-1-amine |
|---|---|
| PubChem CID | 65333102 |
| Molecular Formula | C15H19FN2 |
| Molecular Weight | 246.33 g/mol |
| Exact Mass | 246.15 |
| IUPAC Name | N-ethyl-6-fluoro-8-methyl-2,3,4,9-tetrahydro-1H-carbazol-1-amine |
| SMILES | CCNC1CCCc2c1[nH]c1c(C)cc(F)cc21 |
| InChI | InChI=1S/C15H19FN2/c1-3-17-13-6-4-5-11-12-8-10(16)7-9(2)14(12)18-15(11)13/h7-8,13,17-18H,3-6H2,1-2H3 |
| InChIKey | IELJTAZRQBSNKR-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.33 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|