C15H18Cl2N2 — CID 65333191
6,8-dichloro-N-propyl-2,3,4,9-tetrahydro-1H-carbazol-4-amine (PubChem CID 65333191) has the molecular formula C15H18Cl2N2 and a molecular weight of 297.23 g/mol. Its IUPAC name is 6,8-dichloro-N-propyl-2,3,4,9-tetrahydro-1H-carbazol-4-amine.
| Compound Name | 6,8-dichloro-N-propyl-2,3,4,9-tetrahydro-1H-carbazol-4-amine |
|---|---|
| PubChem CID | 65333191 |
| Molecular Formula | C15H18Cl2N2 |
| Molecular Weight | 297.23 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | 6,8-dichloro-N-propyl-2,3,4,9-tetrahydro-1H-carbazol-4-amine |
| SMILES | CCCNC1CCCc2[nH]c3c(Cl)cc(Cl)cc3c21 |
| InChI | InChI=1S/C15H18Cl2N2/c1-2-6-18-12-4-3-5-13-14(12)10-7-9(16)8-11(17)15(10)19-13/h7-8,12,18-19H,2-6H2,1H3 |
| InChIKey | LVKDPQLOPCMJER-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.23 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|