C13H16N2 — CID 65333308
N-methyl-2,3,4,9-tetrahydro-1H-carbazol-4-amine (PubChem CID 65333308) has the molecular formula C13H16N2 and a molecular weight of 200.29 g/mol. Its IUPAC name is N-methyl-2,3,4,9-tetrahydro-1H-carbazol-4-amine.
| Compound Name | N-methyl-2,3,4,9-tetrahydro-1H-carbazol-4-amine |
|---|---|
| PubChem CID | 65333308 |
| Molecular Formula | C13H16N2 |
| Molecular Weight | 200.29 g/mol |
| Exact Mass | 200.13 |
| IUPAC Name | N-methyl-2,3,4,9-tetrahydro-1H-carbazol-4-amine |
| SMILES | CNC1CCCc2[nH]c3ccccc3c21 |
| InChI | InChI=1S/C13H16N2/c1-14-11-7-4-8-12-13(11)9-5-2-3-6-10(9)15-12/h2-3,5-6,11,14-15H,4,7-8H2,1H3 |
| InChIKey | XCKXMLYJLPJLIZ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.29 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|