C15H17F3N2 — CID 65333328
5,6,8-trifluoro-N-propyl-2,3,4,9-tetrahydro-1H-carbazol-3-amine (PubChem CID 65333328) has the molecular formula C15H17F3N2 and a molecular weight of 282.31 g/mol. Its IUPAC name is 5,6,8-trifluoro-N-propyl-2,3,4,9-tetrahydro-1H-carbazol-3-amine.
| Compound Name | 5,6,8-trifluoro-N-propyl-2,3,4,9-tetrahydro-1H-carbazol-3-amine |
|---|---|
| PubChem CID | 65333328 |
| Molecular Formula | C15H17F3N2 |
| Molecular Weight | 282.31 g/mol |
| Exact Mass | 282.13 |
| IUPAC Name | 5,6,8-trifluoro-N-propyl-2,3,4,9-tetrahydro-1H-carbazol-3-amine |
| SMILES | CCCNC1CCc2[nH]c3c(F)cc(F)c(F)c3c2C1 |
| InChI | InChI=1S/C15H17F3N2/c1-2-5-19-8-3-4-12-9(6-8)13-14(18)10(16)7-11(17)15(13)20-12/h7-8,19-20H,2-6H2,1H3 |
| InChIKey | YRIBURKHAFBGSF-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.31 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|