About 8-fluoro-1,2,4,9-tetrahydrocarbazol-3-one
8-fluoro-1,2,4,9-tetrahydrocarbazol-3-one (PubChem CID 65333661) has the molecular formula C12H10FNO
and a molecular weight of 203.22 g/mol. Its IUPAC name is 8-fluoro-1,2,4,9-tetrahydrocarbazol-3-one.
Molecular Properties
| Compound Name | 8-fluoro-1,2,4,9-tetrahydrocarbazol-3-one |
| PubChem CID | 65333661 |
| Molecular Formula | C12H10FNO |
| Molecular Weight | 203.22 g/mol |
| Exact Mass | 203.07 |
| IUPAC Name | 8-fluoro-1,2,4,9-tetrahydrocarbazol-3-one |
| SMILES | O=C1CCc2[nH]c3c(F)cccc3c2C1 |
| InChI | InChI=1S/C12H10FNO/c13-10-3-1-2-8-9-6-7(15)4-5-11(9)14-12(8)10/h1-3,14H,4-6H2 |
| InChIKey | DHDSIBZJYPKGEA-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.22 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|
Analyze 8-fluoro-1,2,4,9-tetrahydrocarbazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-fluoro-1,2,4,9-tetrahydrocarbazol-3-one?
The IUPAC name of 8-fluoro-1,2,4,9-tetrahydrocarbazol-3-one (CID 65333661) is 8-fluoro-1,2,4,9-tetrahydrocarbazol-3-one.
What is the SMILES notation for 8-fluoro-1,2,4,9-tetrahydrocarbazol-3-one?
The canonical SMILES for 8-fluoro-1,2,4,9-tetrahydrocarbazol-3-one is O=C1CCc2[nH]c3c(F)cccc3c2C1.
What is the InChIKey of 8-fluoro-1,2,4,9-tetrahydrocarbazol-3-one?
The InChIKey is DHDSIBZJYPKGEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10FNO/c13-10-3-1-2-8-9-6-7(15)4-5-11(9)14-12(8)10/h1-3,14H,4-6H2.
What are the key properties of 8-fluoro-1,2,4,9-tetrahydrocarbazol-3-one?
8-fluoro-1,2,4,9-tetrahydrocarbazol-3-one has a molecular weight of 203.22 g/mol, XLogP of 2.36, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 8-fluoro-1,2,4,9-tetrahydrocarbazol-3-one is sourced from PubChem (CID 65333661), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).