C14H25N3O2 — CID 65333945
4-[3-(oxan-3-yl)-1,2,4-oxadiazol-5-yl]-N-propylbutan-2-amine (PubChem CID 65333945) has the molecular formula C14H25N3O2 and a molecular weight of 267.37 g/mol. Its IUPAC name is 4-[3-(oxan-3-yl)-1,2,4-oxadiazol-5-yl]-N-propylbutan-2-amine.
| Compound Name | 4-[3-(oxan-3-yl)-1,2,4-oxadiazol-5-yl]-N-propylbutan-2-amine |
|---|---|
| PubChem CID | 65333945 |
| Molecular Formula | C14H25N3O2 |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.19 |
| IUPAC Name | 4-[3-(oxan-3-yl)-1,2,4-oxadiazol-5-yl]-N-propylbutan-2-amine |
| SMILES | CCCNC(C)CCc1nc(C2CCCOC2)no1 |
| InChI | InChI=1S/C14H25N3O2/c1-3-8-15-11(2)6-7-13-16-14(17-19-13)12-5-4-9-18-10-12/h11-12,15H,3-10H2,1-2H3 |
| InChIKey | IPWKPBNIAFPALE-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 60.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |