C10H15N3OS — CID 65334094
N-cyclopropyl-3-(oxan-3-yl)-1,2,4-thiadiazol-5-amine (PubChem CID 65334094) has the molecular formula C10H15N3OS and a molecular weight of 225.32 g/mol. Its IUPAC name is N-cyclopropyl-3-(oxan-3-yl)-1,2,4-thiadiazol-5-amine.
| Compound Name | N-cyclopropyl-3-(oxan-3-yl)-1,2,4-thiadiazol-5-amine |
|---|---|
| PubChem CID | 65334094 |
| Molecular Formula | C10H15N3OS |
| Molecular Weight | 225.32 g/mol |
| Exact Mass | 225.09 |
| IUPAC Name | N-cyclopropyl-3-(oxan-3-yl)-1,2,4-thiadiazol-5-amine |
| SMILES | C1COCC(c2nsc(NC3CC3)n2)C1 |
| InChI | InChI=1S/C10H15N3OS/c1-2-7(6-14-5-1)9-12-10(15-13-9)11-8-3-4-8/h7-8H,1-6H2,(H,11,12,13) |
| InChIKey | HYPXUVDAGVZFDY-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.32 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |