About N'-benzyl-N'-[2-(cyclopentylamino)-2-oxoethyl]-N-pyridin-2-ylpentanediamide
N'-benzyl-N'-[2-(cyclopentylamino)-2-oxoethyl]-N-pyridin-2-ylpentanediamide (PubChem CID 653349) has the molecular formula C24H30N4O3
and a molecular weight of 422.53 g/mol. Its IUPAC name is N'-benzyl-N'-[2-(cyclopentylamino)-2-oxoethyl]-N-pyridin-2-ylpentanediamide.
Molecular Properties
| Compound Name | N'-benzyl-N'-[2-(cyclopentylamino)-2-oxoethyl]-N-pyridin-2-ylpentanediamide |
| PubChem CID | 653349 |
| Molecular Formula | C24H30N4O3 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.23 |
| IUPAC Name | N'-benzyl-N'-[2-(cyclopentylamino)-2-oxoethyl]-N-pyridin-2-ylpentanediamide |
| SMILES | O=C(CCCC(=O)N(CC(=O)NC1CCCC1)Cc1ccccc1)Nc1ccccn1 |
| InChI | InChI=1S/C24H30N4O3/c29-22(27-21-13-6-7-16-25-21)14-8-15-24(31)28(17-19-9-2-1-3-10-19)18-23(30)26-20-11-4-5-12-20/h1-3,6-7,9-10,13,16,20H,4-5,8,11-12,14-15,17-18H2,(H,26,30)(H,25,27,29) |
| InChIKey | ZBCTYGKOKHTZAB-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N'-benzyl-N'-[2-(cyclopentylamino)-2-oxoethyl]-N-pyridin-2-ylpentanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-benzyl-N'-[2-(cyclopentylamino)-2-oxoethyl]-N-pyridin-2-ylpentanediamide?
The IUPAC name of N'-benzyl-N'-[2-(cyclopentylamino)-2-oxoethyl]-N-pyridin-2-ylpentanediamide (CID 653349) is N'-benzyl-N'-[2-(cyclopentylamino)-2-oxoethyl]-N-pyridin-2-ylpentanediamide.
What is the SMILES notation for N'-benzyl-N'-[2-(cyclopentylamino)-2-oxoethyl]-N-pyridin-2-ylpentanediamide?
The canonical SMILES for N'-benzyl-N'-[2-(cyclopentylamino)-2-oxoethyl]-N-pyridin-2-ylpentanediamide is O=C(CCCC(=O)N(CC(=O)NC1CCCC1)Cc1ccccc1)Nc1ccccn1.
What is the InChIKey of N'-benzyl-N'-[2-(cyclopentylamino)-2-oxoethyl]-N-pyridin-2-ylpentanediamide?
The InChIKey is ZBCTYGKOKHTZAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H30N4O3/c29-22(27-21-13-6-7-16-25-21)14-8-15-24(31)28(17-19-9-2-1-3-10-19)18-23(30)26-20-11-4-5-12-20/h1-3,6-7,9-10,13,16,20H,4-5,8,11-12,14-15,17-18H2,(H,26,30)(H,25,27,29).
What are the key properties of N'-benzyl-N'-[2-(cyclopentylamino)-2-oxoethyl]-N-pyridin-2-ylpentanediamide?
N'-benzyl-N'-[2-(cyclopentylamino)-2-oxoethyl]-N-pyridin-2-ylpentanediamide has a molecular weight of 422.53 g/mol, XLogP of 3.28, 10 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-benzyl-N'-[2-(cyclopentylamino)-2-oxoethyl]-N-pyridin-2-ylpentanediamide is sourced from PubChem (CID 653349), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).