C26H31N3O4 — CID 653350
ethyl 1-[4-(dimethylamino)phenyl]-4,6-dioxo-5-phenyl-3-propyl-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylate (PubChem CID 653350) has the molecular formula C26H31N3O4 and a molecular weight of 449.55 g/mol. Its IUPAC name is ethyl 1-[4-(dimethylamino)phenyl]-4,6-dioxo-5-phenyl-3-propyl-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylate.
| Compound Name | ethyl 1-[4-(dimethylamino)phenyl]-4,6-dioxo-5-phenyl-3-propyl-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 653350 |
| Molecular Formula | C26H31N3O4 |
| Molecular Weight | 449.55 g/mol |
| Exact Mass | 449.23 |
| IUPAC Name | ethyl 1-[4-(dimethylamino)phenyl]-4,6-dioxo-5-phenyl-3-propyl-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylate |
| SMILES | CCCC1(C(=O)OCC)NC(c2ccc(N(C)C)cc2)C2C(=O)N(c3ccccc3)C(=O)C21 |
| InChI | InChI=1S/C26H31N3O4/c1-5-16-26(25(32)33-6-2)21-20(22(27-26)17-12-14-18(15-13-17)28(3)4)23(30)29(24(21)31)19-10-8-7-9-11-19/h7-15,20-22,27H,5-6,16H2,1-4H3 |
| InChIKey | ZPFBYZXLZPIINH-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.55 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|