About 2-(azepan-2-yl)-[1,3]thiazolo[5,4-b]pyridine
2-(azepan-2-yl)-[1,3]thiazolo[5,4-b]pyridine (PubChem CID 65335157) has the molecular formula C12H15N3S
and a molecular weight of 233.34 g/mol. Its IUPAC name is 2-(azepan-2-yl)-[1,3]thiazolo[5,4-b]pyridine.
Molecular Properties
| Compound Name | 2-(azepan-2-yl)-[1,3]thiazolo[5,4-b]pyridine |
| PubChem CID | 65335157 |
| Molecular Formula | C12H15N3S |
| Molecular Weight | 233.34 g/mol |
| Exact Mass | 233.10 |
| IUPAC Name | 2-(azepan-2-yl)-[1,3]thiazolo[5,4-b]pyridine |
| SMILES | c1cnc2sc(C3CCCCCN3)nc2c1 |
| InChI | InChI=1S/C12H15N3S/c1-2-5-9(13-7-3-1)12-15-10-6-4-8-14-11(10)16-12/h4,6,8-9,13H,1-3,5,7H2 |
| InChIKey | CQHIUFPJMXLCAD-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.34 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(azepan-2-yl)-[1,3]thiazolo[5,4-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(azepan-2-yl)-[1,3]thiazolo[5,4-b]pyridine?
The IUPAC name of 2-(azepan-2-yl)-[1,3]thiazolo[5,4-b]pyridine (CID 65335157) is 2-(azepan-2-yl)-[1,3]thiazolo[5,4-b]pyridine.
What is the SMILES notation for 2-(azepan-2-yl)-[1,3]thiazolo[5,4-b]pyridine?
The canonical SMILES for 2-(azepan-2-yl)-[1,3]thiazolo[5,4-b]pyridine is c1cnc2sc(C3CCCCCN3)nc2c1.
What is the InChIKey of 2-(azepan-2-yl)-[1,3]thiazolo[5,4-b]pyridine?
The InChIKey is CQHIUFPJMXLCAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15N3S/c1-2-5-9(13-7-3-1)12-15-10-6-4-8-14-11(10)16-12/h4,6,8-9,13H,1-3,5,7H2.
What are the key properties of 2-(azepan-2-yl)-[1,3]thiazolo[5,4-b]pyridine?
2-(azepan-2-yl)-[1,3]thiazolo[5,4-b]pyridine has a molecular weight of 233.34 g/mol, XLogP of 2.90, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(azepan-2-yl)-[1,3]thiazolo[5,4-b]pyridine is sourced from PubChem (CID 65335157), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).