C14H17ClN2 — CID 65335339
6-chloro-2-propyl-1,3,4,5-tetrahydropyrido[4,3-b]indole (PubChem CID 65335339) has the molecular formula C14H17ClN2 and a molecular weight of 248.76 g/mol. Its IUPAC name is 6-chloro-2-propyl-1,3,4,5-tetrahydropyrido[4,3-b]indole.
| Compound Name | 6-chloro-2-propyl-1,3,4,5-tetrahydropyrido[4,3-b]indole |
|---|---|
| PubChem CID | 65335339 |
| Molecular Formula | C14H17ClN2 |
| Molecular Weight | 248.76 g/mol |
| Exact Mass | 248.11 |
| IUPAC Name | 6-chloro-2-propyl-1,3,4,5-tetrahydropyrido[4,3-b]indole |
| SMILES | CCCN1CCc2[nH]c3c(Cl)cccc3c2C1 |
| InChI | InChI=1S/C14H17ClN2/c1-2-7-17-8-6-13-11(9-17)10-4-3-5-12(15)14(10)16-13/h3-5,16H,2,6-9H2,1H3 |
| InChIKey | WLPRAADHILRGIL-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.76 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|