C14H15Cl2N — CID 65335430
2,4-dichloro-6,7,8,9,10,11-hexahydro-5H-cycloocta[b]indole (PubChem CID 65335430) has the molecular formula C14H15Cl2N and a molecular weight of 268.19 g/mol. Its IUPAC name is 2,4-dichloro-6,7,8,9,10,11-hexahydro-5H-cycloocta[b]indole.
| Compound Name | 2,4-dichloro-6,7,8,9,10,11-hexahydro-5H-cycloocta[b]indole |
|---|---|
| PubChem CID | 65335430 |
| Molecular Formula | C14H15Cl2N |
| Molecular Weight | 268.19 g/mol |
| Exact Mass | 267.06 |
| IUPAC Name | 2,4-dichloro-6,7,8,9,10,11-hexahydro-5H-cycloocta[b]indole |
| SMILES | Clc1cc(Cl)c2[nH]c3c(c2c1)CCCCCC3 |
| InChI | InChI=1S/C14H15Cl2N/c15-9-7-11-10-5-3-1-2-4-6-13(10)17-14(11)12(16)8-9/h7-8,17H,1-6H2 |
| InChIKey | DEMHSBPAMODNMP-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.19 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|