C13H16N2O2 — CID 65335449
5-methoxy-N,N,2-trimethyl-1H-indole-3-carboxamide (PubChem CID 65335449) has the molecular formula C13H16N2O2 and a molecular weight of 232.28 g/mol. Its IUPAC name is 5-methoxy-N,N,2-trimethyl-1H-indole-3-carboxamide.
| Compound Name | 5-methoxy-N,N,2-trimethyl-1H-indole-3-carboxamide |
|---|---|
| PubChem CID | 65335449 |
| Molecular Formula | C13H16N2O2 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.12 |
| IUPAC Name | 5-methoxy-N,N,2-trimethyl-1H-indole-3-carboxamide |
| SMILES | COc1ccc2[nH]c(C)c(C(=O)N(C)C)c2c1 |
| InChI | InChI=1S/C13H16N2O2/c1-8-12(13(16)15(2)3)10-7-9(17-4)5-6-11(10)14-8/h5-7,14H,1-4H3 |
| InChIKey | MTGFCTDRWOJLLA-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |