C11H8F3NO — CID 65335500
6,8,9-trifluoro-1,3,4,5-tetrahydropyrano[4,3-b]indole (PubChem CID 65335500) has the molecular formula C11H8F3NO and a molecular weight of 227.18 g/mol. Its IUPAC name is 6,8,9-trifluoro-1,3,4,5-tetrahydropyrano[4,3-b]indole.
| Compound Name | 6,8,9-trifluoro-1,3,4,5-tetrahydropyrano[4,3-b]indole |
|---|---|
| PubChem CID | 65335500 |
| Molecular Formula | C11H8F3NO |
| Molecular Weight | 227.18 g/mol |
| Exact Mass | 227.06 |
| IUPAC Name | 6,8,9-trifluoro-1,3,4,5-tetrahydropyrano[4,3-b]indole |
| SMILES | Fc1cc(F)c2[nH]c3c(c2c1F)COCC3 |
| InChI | InChI=1S/C11H8F3NO/c12-6-3-7(13)11-9(10(6)14)5-4-16-2-1-8(5)15-11/h3,15H,1-2,4H2 |
| InChIKey | HXNOHHKKCIZLSP-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 25.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.18 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|