About 1-([1,3]thiazolo[5,4-b]pyridin-2-yl)propan-1-amine
1-([1,3]thiazolo[5,4-b]pyridin-2-yl)propan-1-amine (PubChem CID 65335679) has the molecular formula C9H11N3S
and a molecular weight of 193.27 g/mol. Its IUPAC name is 1-([1,3]thiazolo[5,4-b]pyridin-2-yl)propan-1-amine.
Molecular Properties
| Compound Name | 1-([1,3]thiazolo[5,4-b]pyridin-2-yl)propan-1-amine |
| PubChem CID | 65335679 |
| Molecular Formula | C9H11N3S |
| Molecular Weight | 193.27 g/mol |
| Exact Mass | 193.07 |
| IUPAC Name | 1-([1,3]thiazolo[5,4-b]pyridin-2-yl)propan-1-amine |
| SMILES | CCC(N)c1nc2cccnc2s1 |
| InChI | InChI=1S/C9H11N3S/c1-2-6(10)8-12-7-4-3-5-11-9(7)13-8/h3-6H,2,10H2,1H3 |
| InChIKey | AUNBFRDPXJYHIR-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.27 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-([1,3]thiazolo[5,4-b]pyridin-2-yl)propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-([1,3]thiazolo[5,4-b]pyridin-2-yl)propan-1-amine?
The IUPAC name of 1-([1,3]thiazolo[5,4-b]pyridin-2-yl)propan-1-amine (CID 65335679) is 1-([1,3]thiazolo[5,4-b]pyridin-2-yl)propan-1-amine.
What is the SMILES notation for 1-([1,3]thiazolo[5,4-b]pyridin-2-yl)propan-1-amine?
The canonical SMILES for 1-([1,3]thiazolo[5,4-b]pyridin-2-yl)propan-1-amine is CCC(N)c1nc2cccnc2s1.
What is the InChIKey of 1-([1,3]thiazolo[5,4-b]pyridin-2-yl)propan-1-amine?
The InChIKey is AUNBFRDPXJYHIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N3S/c1-2-6(10)8-12-7-4-3-5-11-9(7)13-8/h3-6H,2,10H2,1H3.
What are the key properties of 1-([1,3]thiazolo[5,4-b]pyridin-2-yl)propan-1-amine?
1-([1,3]thiazolo[5,4-b]pyridin-2-yl)propan-1-amine has a molecular weight of 193.27 g/mol, XLogP of 2.10, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-([1,3]thiazolo[5,4-b]pyridin-2-yl)propan-1-amine is sourced from PubChem (CID 65335679), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).