About N-(1-hydroxy-2-methyl-6,7-dihydro-5H-benzimidazol-4-ylidene)hydroxylamine
N-(1-hydroxy-2-methyl-6,7-dihydro-5H-benzimidazol-4-ylidene)hydroxylamine (PubChem CID 653357) has the molecular formula C8H11N3O2
and a molecular weight of 181.19 g/mol. Its IUPAC name is N-(1-hydroxy-2-methyl-6,7-dihydro-5H-benzimidazol-4-ylidene)hydroxylamine.
Molecular Properties
| Compound Name | N-(1-hydroxy-2-methyl-6,7-dihydro-5H-benzimidazol-4-ylidene)hydroxylamine |
| PubChem CID | 653357 |
| Molecular Formula | C8H11N3O2 |
| Molecular Weight | 181.19 g/mol |
| Exact Mass | 181.09 |
| IUPAC Name | N-(1-hydroxy-2-methyl-6,7-dihydro-5H-benzimidazol-4-ylidene)hydroxylamine |
| SMILES | Cc1nc2c(n1O)CCCC2=NO |
| InChI | InChI=1S/C8H11N3O2/c1-5-9-8-6(10-12)3-2-4-7(8)11(5)13/h12-13H,2-4H2,1H3 |
| InChIKey | MBRAXOWMEHLJIO-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 70.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.19 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(1-hydroxy-2-methyl-6,7-dihydro-5H-benzimidazol-4-ylidene)hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-hydroxy-2-methyl-6,7-dihydro-5H-benzimidazol-4-ylidene)hydroxylamine?
The IUPAC name of N-(1-hydroxy-2-methyl-6,7-dihydro-5H-benzimidazol-4-ylidene)hydroxylamine (CID 653357) is N-(1-hydroxy-2-methyl-6,7-dihydro-5H-benzimidazol-4-ylidene)hydroxylamine.
What is the SMILES notation for N-(1-hydroxy-2-methyl-6,7-dihydro-5H-benzimidazol-4-ylidene)hydroxylamine?
The canonical SMILES for N-(1-hydroxy-2-methyl-6,7-dihydro-5H-benzimidazol-4-ylidene)hydroxylamine is Cc1nc2c(n1O)CCCC2=NO.
What is the InChIKey of N-(1-hydroxy-2-methyl-6,7-dihydro-5H-benzimidazol-4-ylidene)hydroxylamine?
The InChIKey is MBRAXOWMEHLJIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N3O2/c1-5-9-8-6(10-12)3-2-4-7(8)11(5)13/h12-13H,2-4H2,1H3.
What are the key properties of N-(1-hydroxy-2-methyl-6,7-dihydro-5H-benzimidazol-4-ylidene)hydroxylamine?
N-(1-hydroxy-2-methyl-6,7-dihydro-5H-benzimidazol-4-ylidene)hydroxylamine has a molecular weight of 181.19 g/mol, XLogP of 0.94, 0 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-hydroxy-2-methyl-6,7-dihydro-5H-benzimidazol-4-ylidene)hydroxylamine is sourced from PubChem (CID 653357), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).