C14H15F2N — CID 65335745
6,8-difluoro-3,3-dimethyl-1,2,4,9-tetrahydrocarbazole (PubChem CID 65335745) has the molecular formula C14H15F2N and a molecular weight of 235.28 g/mol. Its IUPAC name is 6,8-difluoro-3,3-dimethyl-1,2,4,9-tetrahydrocarbazole.
| Compound Name | 6,8-difluoro-3,3-dimethyl-1,2,4,9-tetrahydrocarbazole |
|---|---|
| PubChem CID | 65335745 |
| Molecular Formula | C14H15F2N |
| Molecular Weight | 235.28 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | 6,8-difluoro-3,3-dimethyl-1,2,4,9-tetrahydrocarbazole |
| SMILES | CC1(C)CCc2[nH]c3c(F)cc(F)cc3c2C1 |
| InChI | InChI=1S/C14H15F2N/c1-14(2)4-3-12-10(7-14)9-5-8(15)6-11(16)13(9)17-12/h5-6,17H,3-4,7H2,1-2H3 |
| InChIKey | BAWCYRANRYICAV-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.28 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|