About 5-nitro-2-([1,3]thiazolo[5,4-b]pyridin-2-yl)aniline
5-nitro-2-([1,3]thiazolo[5,4-b]pyridin-2-yl)aniline (PubChem CID 65335840) has the molecular formula C12H8N4O2S
and a molecular weight of 272.29 g/mol. Its IUPAC name is 5-nitro-2-([1,3]thiazolo[5,4-b]pyridin-2-yl)aniline.
Molecular Properties
| Compound Name | 5-nitro-2-([1,3]thiazolo[5,4-b]pyridin-2-yl)aniline |
| PubChem CID | 65335840 |
| Molecular Formula | C12H8N4O2S |
| Molecular Weight | 272.29 g/mol |
| Exact Mass | 272.04 |
| IUPAC Name | 5-nitro-2-([1,3]thiazolo[5,4-b]pyridin-2-yl)aniline |
| SMILES | Nc1cc([N+](=O)[O-])ccc1-c1nc2cccnc2s1 |
| InChI | InChI=1S/C12H8N4O2S/c13-9-6-7(16(17)18)3-4-8(9)11-15-10-2-1-5-14-12(10)19-11/h1-6H,13H2 |
| InChIKey | SZSGDXPEIHIMFB-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 94.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.29 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-nitro-2-([1,3]thiazolo[5,4-b]pyridin-2-yl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-nitro-2-([1,3]thiazolo[5,4-b]pyridin-2-yl)aniline?
The IUPAC name of 5-nitro-2-([1,3]thiazolo[5,4-b]pyridin-2-yl)aniline (CID 65335840) is 5-nitro-2-([1,3]thiazolo[5,4-b]pyridin-2-yl)aniline.
What is the SMILES notation for 5-nitro-2-([1,3]thiazolo[5,4-b]pyridin-2-yl)aniline?
The canonical SMILES for 5-nitro-2-([1,3]thiazolo[5,4-b]pyridin-2-yl)aniline is Nc1cc([N+](=O)[O-])ccc1-c1nc2cccnc2s1.
What is the InChIKey of 5-nitro-2-([1,3]thiazolo[5,4-b]pyridin-2-yl)aniline?
The InChIKey is SZSGDXPEIHIMFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8N4O2S/c13-9-6-7(16(17)18)3-4-8(9)11-15-10-2-1-5-14-12(10)19-11/h1-6H,13H2.
What are the key properties of 5-nitro-2-([1,3]thiazolo[5,4-b]pyridin-2-yl)aniline?
5-nitro-2-([1,3]thiazolo[5,4-b]pyridin-2-yl)aniline has a molecular weight of 272.29 g/mol, XLogP of 2.85, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-nitro-2-([1,3]thiazolo[5,4-b]pyridin-2-yl)aniline is sourced from PubChem (CID 65335840), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).