C18H12N4O6 — CID 6533590
(3Z,6Z)-3,6-bis[(2-nitrophenyl)methylidene]piperazine-2,5-dione (PubChem CID 6533590) has the molecular formula C18H12N4O6 and a molecular weight of 380.32 g/mol. Its IUPAC name is (3Z,6Z)-3,6-bis[(2-nitrophenyl)methylidene]piperazine-2,5-dione.
| Compound Name | (3Z,6Z)-3,6-bis[(2-nitrophenyl)methylidene]piperazine-2,5-dione |
|---|---|
| PubChem CID | 6533590 |
| Molecular Formula | C18H12N4O6 |
| Molecular Weight | 380.32 g/mol |
| Exact Mass | 380.08 |
| IUPAC Name | (3Z,6Z)-3,6-bis[(2-nitrophenyl)methylidene]piperazine-2,5-dione |
| SMILES | O=c1[nH]/c(=C\c2ccccc2[N+](=O)[O-])c(=O)[nH]/c1=C\c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H12N4O6/c23-17-13(9-11-5-1-3-7-15(11)21(25)26)19-18(24)14(20-17)10-12-6-2-4-8-16(12)22(27)28/h1-10H,(H,19,24)(H,20,23)/b13-9-,14-10- |
| InChIKey | LSZORODYBADFLT-FOIMCPNXSA-N |
| XLogP | 0.54 |
| TPSA | 152.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.32 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|