C15H12F2N2O — CID 65336585
5-[(3,5-difluoroanilino)methyl]-2-methoxybenzonitrile (PubChem CID 65336585) has the molecular formula C15H12F2N2O and a molecular weight of 274.27 g/mol. Its IUPAC name is 5-[(3,5-difluoroanilino)methyl]-2-methoxybenzonitrile.
| Compound Name | 5-[(3,5-difluoroanilino)methyl]-2-methoxybenzonitrile |
|---|---|
| PubChem CID | 65336585 |
| Molecular Formula | C15H12F2N2O |
| Molecular Weight | 274.27 g/mol |
| Exact Mass | 274.09 |
| IUPAC Name | 5-[(3,5-difluoroanilino)methyl]-2-methoxybenzonitrile |
| SMILES | COc1ccc(CNc2cc(F)cc(F)c2)cc1C#N |
| InChI | InChI=1S/C15H12F2N2O/c1-20-15-3-2-10(4-11(15)8-18)9-19-14-6-12(16)5-13(17)7-14/h2-7,19H,9H2,1H3 |
| InChIKey | FHTYIIXACHRHNV-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.27 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |