About 4-N-[(5-methyl-1,2-oxazol-3-yl)methyl]quinazoline-4,7-diamine
4-N-[(5-methyl-1,2-oxazol-3-yl)methyl]quinazoline-4,7-diamine (PubChem CID 65336736) has the molecular formula C13H13N5O
and a molecular weight of 255.28 g/mol. Its IUPAC name is 4-N-[(5-methyl-1,2-oxazol-3-yl)methyl]quinazoline-4,7-diamine.
Molecular Properties
| Compound Name | 4-N-[(5-methyl-1,2-oxazol-3-yl)methyl]quinazoline-4,7-diamine |
| PubChem CID | 65336736 |
| Molecular Formula | C13H13N5O |
| Molecular Weight | 255.28 g/mol |
| Exact Mass | 255.11 |
| IUPAC Name | 4-N-[(5-methyl-1,2-oxazol-3-yl)methyl]quinazoline-4,7-diamine |
| SMILES | Cc1cc(CNc2ncnc3cc(N)ccc23)no1 |
| InChI | InChI=1S/C13H13N5O/c1-8-4-10(18-19-8)6-15-13-11-3-2-9(14)5-12(11)16-7-17-13/h2-5,7H,6,14H2,1H3,(H,15,16,17) |
| InChIKey | MJOCZPFZYBYXQN-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 89.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.28 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-N-[(5-methyl-1,2-oxazol-3-yl)methyl]quinazoline-4,7-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-N-[(5-methyl-1,2-oxazol-3-yl)methyl]quinazoline-4,7-diamine?
The IUPAC name of 4-N-[(5-methyl-1,2-oxazol-3-yl)methyl]quinazoline-4,7-diamine (CID 65336736) is 4-N-[(5-methyl-1,2-oxazol-3-yl)methyl]quinazoline-4,7-diamine.
What is the SMILES notation for 4-N-[(5-methyl-1,2-oxazol-3-yl)methyl]quinazoline-4,7-diamine?
The canonical SMILES for 4-N-[(5-methyl-1,2-oxazol-3-yl)methyl]quinazoline-4,7-diamine is Cc1cc(CNc2ncnc3cc(N)ccc23)no1.
What is the InChIKey of 4-N-[(5-methyl-1,2-oxazol-3-yl)methyl]quinazoline-4,7-diamine?
The InChIKey is MJOCZPFZYBYXQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13N5O/c1-8-4-10(18-19-8)6-15-13-11-3-2-9(14)5-12(11)16-7-17-13/h2-5,7H,6,14H2,1H3,(H,15,16,17).
What are the key properties of 4-N-[(5-methyl-1,2-oxazol-3-yl)methyl]quinazoline-4,7-diamine?
4-N-[(5-methyl-1,2-oxazol-3-yl)methyl]quinazoline-4,7-diamine has a molecular weight of 255.28 g/mol, XLogP of 2.12, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-N-[(5-methyl-1,2-oxazol-3-yl)methyl]quinazoline-4,7-diamine is sourced from PubChem (CID 65336736), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).