C20H18N4O4 — CID 6533691
methyl 4-[[(Z)-2-(5-methyltetrazol-1-yl)-3-phenylprop-2-enoyl]oxymethyl]benzoate (PubChem CID 6533691) has the molecular formula C20H18N4O4 and a molecular weight of 378.39 g/mol. Its IUPAC name is methyl 4-[[(Z)-2-(5-methyltetrazol-1-yl)-3-phenylprop-2-enoyl]oxymethyl]benzoate.
| Compound Name | methyl 4-[[(Z)-2-(5-methyltetrazol-1-yl)-3-phenylprop-2-enoyl]oxymethyl]benzoate |
|---|---|
| PubChem CID | 6533691 |
| Molecular Formula | C20H18N4O4 |
| Molecular Weight | 378.39 g/mol |
| Exact Mass | 378.13 |
| IUPAC Name | methyl 4-[[(Z)-2-(5-methyltetrazol-1-yl)-3-phenylprop-2-enoyl]oxymethyl]benzoate |
| SMILES | COC(=O)c1ccc(COC(=O)/C(=C/c2ccccc2)n2nnnc2C)cc1 |
| InChI | InChI=1S/C20H18N4O4/c1-14-21-22-23-24(14)18(12-15-6-4-3-5-7-15)20(26)28-13-16-8-10-17(11-9-16)19(25)27-2/h3-12H,13H2,1-2H3/b18-12- |
| InChIKey | WTEVYARTSSSCCH-PDGQHHTCSA-N |
| XLogP | 2.51 |
| TPSA | 96.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.39 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|