C17H22N2O2 — CID 65338927
[2-methoxy-5-(3-pyridin-4-ylpropoxymethyl)phenyl]methanamine (PubChem CID 65338927) has the molecular formula C17H22N2O2 and a molecular weight of 286.38 g/mol. Its IUPAC name is [2-methoxy-5-(3-pyridin-4-ylpropoxymethyl)phenyl]methanamine.
| Compound Name | [2-methoxy-5-(3-pyridin-4-ylpropoxymethyl)phenyl]methanamine |
|---|---|
| PubChem CID | 65338927 |
| Molecular Formula | C17H22N2O2 |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | [2-methoxy-5-(3-pyridin-4-ylpropoxymethyl)phenyl]methanamine |
| SMILES | COc1ccc(COCCCc2ccncc2)cc1CN |
| InChI | InChI=1S/C17H22N2O2/c1-20-17-5-4-15(11-16(17)12-18)13-21-10-2-3-14-6-8-19-9-7-14/h4-9,11H,2-3,10,12-13,18H2,1H3 |
| InChIKey | XBVRWOZSTXWKDA-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 57.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|