C13H18N2O3S2 — CID 65339019
5-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]-2-methoxybenzenecarbothioamide (PubChem CID 65339019) has the molecular formula C13H18N2O3S2 and a molecular weight of 314.43 g/mol. Its IUPAC name is 5-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]-2-methoxybenzenecarbothioamide.
| Compound Name | 5-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]-2-methoxybenzenecarbothioamide |
|---|---|
| PubChem CID | 65339019 |
| Molecular Formula | C13H18N2O3S2 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.08 |
| IUPAC Name | 5-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]-2-methoxybenzenecarbothioamide |
| SMILES | COc1ccc(CN2CCS(=O)(=O)CC2)cc1C(N)=S |
| InChI | InChI=1S/C13H18N2O3S2/c1-18-12-3-2-10(8-11(12)13(14)19)9-15-4-6-20(16,17)7-5-15/h2-3,8H,4-7,9H2,1H3,(H2,14,19) |
| InChIKey | NBMVAIASFVVQDX-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|