5-[(N,3-dimethylanilino)methyl]-2-methoxybenzoic acid

C17H19NO3 — CID 65339079

IUPAC5-[(N,3-dimethylanilino)methyl]-2-methoxybenzoic acid
SMILESCOc1ccc(CN(C)c2cccc(C)c2)cc1C(=O)O
InChIInChI=1S/C17H19NO3/c1-12-5-4-6-14(9-12)18(2)11-13-7-8-16(21-3)15(10-13)17(19)20/h4-10H,11H2,1-3H3,(H,19,20)
InChIKeyWWCYMZICAKCYSY-UHFFFAOYSA-N
MW285.34 g/mol
LogP3.34
Rot. Bonds5

About 5-[(N,3-dimethylanilino)methyl]-2-methoxybenzoic acid

5-[(N,3-dimethylanilino)methyl]-2-methoxybenzoic acid (PubChem CID 65339079) has the molecular formula C17H19NO3 and a molecular weight of 285.34 g/mol. Its IUPAC name is 5-[(N,3-dimethylanilino)methyl]-2-methoxybenzoic acid.

Molecular Properties

Compound Name5-[(N,3-dimethylanilino)methyl]-2-methoxybenzoic acid
PubChem CID65339079
Molecular FormulaC17H19NO3
Molecular Weight285.34 g/mol
Exact Mass285.14
IUPAC Name5-[(N,3-dimethylanilino)methyl]-2-methoxybenzoic acid
SMILESCOc1ccc(CN(C)c2cccc(C)c2)cc1C(=O)O
InChIInChI=1S/C17H19NO3/c1-12-5-4-6-14(9-12)18(2)11-13-7-8-16(21-3)15(10-13)17(19)20/h4-10H,11H2,1-3H3,(H,19,20)
InChIKeyWWCYMZICAKCYSY-UHFFFAOYSA-N
XLogP3.34
TPSA49.77 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500285.34
LogP ≤ 53.34
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 5-[(N,3-dimethylanilino)methyl]-2-methoxybenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-[(N,3-dimethylanilino)methyl]-2-methoxybenzoic acid?
The IUPAC name of 5-[(N,3-dimethylanilino)methyl]-2-methoxybenzoic acid (CID 65339079) is 5-[(N,3-dimethylanilino)methyl]-2-methoxybenzoic acid.
What is the SMILES notation for 5-[(N,3-dimethylanilino)methyl]-2-methoxybenzoic acid?
The canonical SMILES for 5-[(N,3-dimethylanilino)methyl]-2-methoxybenzoic acid is COc1ccc(CN(C)c2cccc(C)c2)cc1C(=O)O.
What is the InChIKey of 5-[(N,3-dimethylanilino)methyl]-2-methoxybenzoic acid?
The InChIKey is WWCYMZICAKCYSY-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19NO3/c1-12-5-4-6-14(9-12)18(2)11-13-7-8-16(21-3)15(10-13)17(19)20/h4-10H,11H2,1-3H3,(H,19,20).
What are the key properties of 5-[(N,3-dimethylanilino)methyl]-2-methoxybenzoic acid?
5-[(N,3-dimethylanilino)methyl]-2-methoxybenzoic acid has a molecular weight of 285.34 g/mol, XLogP of 3.34, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(N,3-dimethylanilino)methyl]-2-methoxybenzoic acid is sourced from PubChem (CID 65339079), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).