About [5-[(2,5-dimethylmorpholin-4-yl)methyl]-2-methoxyphenyl]methanamine
[5-[(2,5-dimethylmorpholin-4-yl)methyl]-2-methoxyphenyl]methanamine (PubChem CID 65340989) has the molecular formula C15H24N2O2
and a molecular weight of 264.37 g/mol. Its IUPAC name is [5-[(2,5-dimethylmorpholin-4-yl)methyl]-2-methoxyphenyl]methanamine.
Molecular Properties
| Compound Name | [5-[(2,5-dimethylmorpholin-4-yl)methyl]-2-methoxyphenyl]methanamine |
| PubChem CID | 65340989 |
| Molecular Formula | C15H24N2O2 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.18 |
| IUPAC Name | [5-[(2,5-dimethylmorpholin-4-yl)methyl]-2-methoxyphenyl]methanamine |
| SMILES | COc1ccc(CN2CC(C)OCC2C)cc1CN |
| InChI | InChI=1S/C15H24N2O2/c1-11-10-19-12(2)8-17(11)9-13-4-5-15(18-3)14(6-13)7-16/h4-6,11-12H,7-10,16H2,1-3H3 |
| InChIKey | DWDFQYGPOKEFLV-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [5-[(2,5-dimethylmorpholin-4-yl)methyl]-2-methoxyphenyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-[(2,5-dimethylmorpholin-4-yl)methyl]-2-methoxyphenyl]methanamine?
The IUPAC name of [5-[(2,5-dimethylmorpholin-4-yl)methyl]-2-methoxyphenyl]methanamine (CID 65340989) is [5-[(2,5-dimethylmorpholin-4-yl)methyl]-2-methoxyphenyl]methanamine.
What is the SMILES notation for [5-[(2,5-dimethylmorpholin-4-yl)methyl]-2-methoxyphenyl]methanamine?
The canonical SMILES for [5-[(2,5-dimethylmorpholin-4-yl)methyl]-2-methoxyphenyl]methanamine is COc1ccc(CN2CC(C)OCC2C)cc1CN.
What is the InChIKey of [5-[(2,5-dimethylmorpholin-4-yl)methyl]-2-methoxyphenyl]methanamine?
The InChIKey is DWDFQYGPOKEFLV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24N2O2/c1-11-10-19-12(2)8-17(11)9-13-4-5-15(18-3)14(6-13)7-16/h4-6,11-12H,7-10,16H2,1-3H3.
What are the key properties of [5-[(2,5-dimethylmorpholin-4-yl)methyl]-2-methoxyphenyl]methanamine?
[5-[(2,5-dimethylmorpholin-4-yl)methyl]-2-methoxyphenyl]methanamine has a molecular weight of 264.37 g/mol, XLogP of 1.76, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [5-[(2,5-dimethylmorpholin-4-yl)methyl]-2-methoxyphenyl]methanamine is sourced from PubChem (CID 65340989), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).