About 2-methoxy-5-(4-oxo-2,3-dihydropyran-2-yl)benzonitrile
2-methoxy-5-(4-oxo-2,3-dihydropyran-2-yl)benzonitrile (PubChem CID 65341167) has the molecular formula C13H11NO3
and a molecular weight of 229.23 g/mol. Its IUPAC name is 2-methoxy-5-(4-oxo-2,3-dihydropyran-2-yl)benzonitrile.
Molecular Properties
| Compound Name | 2-methoxy-5-(4-oxo-2,3-dihydropyran-2-yl)benzonitrile |
| PubChem CID | 65341167 |
| Molecular Formula | C13H11NO3 |
| Molecular Weight | 229.23 g/mol |
| Exact Mass | 229.07 |
| IUPAC Name | 2-methoxy-5-(4-oxo-2,3-dihydropyran-2-yl)benzonitrile |
| SMILES | COc1ccc(C2CC(=O)C=CO2)cc1C#N |
| InChI | InChI=1S/C13H11NO3/c1-16-12-3-2-9(6-10(12)8-14)13-7-11(15)4-5-17-13/h2-6,13H,7H2,1H3 |
| InChIKey | CJHNALFSCFZALF-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.23 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-methoxy-5-(4-oxo-2,3-dihydropyran-2-yl)benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxy-5-(4-oxo-2,3-dihydropyran-2-yl)benzonitrile?
The IUPAC name of 2-methoxy-5-(4-oxo-2,3-dihydropyran-2-yl)benzonitrile (CID 65341167) is 2-methoxy-5-(4-oxo-2,3-dihydropyran-2-yl)benzonitrile.
What is the SMILES notation for 2-methoxy-5-(4-oxo-2,3-dihydropyran-2-yl)benzonitrile?
The canonical SMILES for 2-methoxy-5-(4-oxo-2,3-dihydropyran-2-yl)benzonitrile is COc1ccc(C2CC(=O)C=CO2)cc1C#N.
What is the InChIKey of 2-methoxy-5-(4-oxo-2,3-dihydropyran-2-yl)benzonitrile?
The InChIKey is CJHNALFSCFZALF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11NO3/c1-16-12-3-2-9(6-10(12)8-14)13-7-11(15)4-5-17-13/h2-6,13H,7H2,1H3.
What are the key properties of 2-methoxy-5-(4-oxo-2,3-dihydropyran-2-yl)benzonitrile?
2-methoxy-5-(4-oxo-2,3-dihydropyran-2-yl)benzonitrile has a molecular weight of 229.23 g/mol, XLogP of 2.11, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxy-5-(4-oxo-2,3-dihydropyran-2-yl)benzonitrile is sourced from PubChem (CID 65341167), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).