About 4-bromo-2-N,2-N-dipropylbenzene-1,2-diamine
4-bromo-2-N,2-N-dipropylbenzene-1,2-diamine (PubChem CID 65341551) has the molecular formula C12H19BrN2
and a molecular weight of 271.20 g/mol. Its IUPAC name is 4-bromo-2-N,2-N-dipropylbenzene-1,2-diamine.
Molecular Properties
| Compound Name | 4-bromo-2-N,2-N-dipropylbenzene-1,2-diamine |
| PubChem CID | 65341551 |
| Molecular Formula | C12H19BrN2 |
| Molecular Weight | 271.20 g/mol |
| Exact Mass | 270.07 |
| IUPAC Name | 4-bromo-2-N,2-N-dipropylbenzene-1,2-diamine |
| SMILES | CCCN(CCC)c1cc(Br)ccc1N |
| InChI | InChI=1S/C12H19BrN2/c1-3-7-15(8-4-2)12-9-10(13)5-6-11(12)14/h5-6,9H,3-4,7-8,14H2,1-2H3 |
| InChIKey | QTPJXHOSBUGFPU-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.20 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-bromo-2-N,2-N-dipropylbenzene-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-2-N,2-N-dipropylbenzene-1,2-diamine?
The IUPAC name of 4-bromo-2-N,2-N-dipropylbenzene-1,2-diamine (CID 65341551) is 4-bromo-2-N,2-N-dipropylbenzene-1,2-diamine.
What is the SMILES notation for 4-bromo-2-N,2-N-dipropylbenzene-1,2-diamine?
The canonical SMILES for 4-bromo-2-N,2-N-dipropylbenzene-1,2-diamine is CCCN(CCC)c1cc(Br)ccc1N.
What is the InChIKey of 4-bromo-2-N,2-N-dipropylbenzene-1,2-diamine?
The InChIKey is QTPJXHOSBUGFPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19BrN2/c1-3-7-15(8-4-2)12-9-10(13)5-6-11(12)14/h5-6,9H,3-4,7-8,14H2,1-2H3.
What are the key properties of 4-bromo-2-N,2-N-dipropylbenzene-1,2-diamine?
4-bromo-2-N,2-N-dipropylbenzene-1,2-diamine has a molecular weight of 271.20 g/mol, XLogP of 3.66, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-2-N,2-N-dipropylbenzene-1,2-diamine is sourced from PubChem (CID 65341551), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).