C11H17BrN2 — CID 65342354
4-bromo-2-N-(2-methylbutyl)benzene-1,2-diamine (PubChem CID 65342354) has the molecular formula C11H17BrN2 and a molecular weight of 257.17 g/mol. Its IUPAC name is 4-bromo-2-N-(2-methylbutyl)benzene-1,2-diamine.
| Compound Name | 4-bromo-2-N-(2-methylbutyl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 65342354 |
| Molecular Formula | C11H17BrN2 |
| Molecular Weight | 257.17 g/mol |
| Exact Mass | 256.06 |
| IUPAC Name | 4-bromo-2-N-(2-methylbutyl)benzene-1,2-diamine |
| SMILES | CCC(C)CNc1cc(Br)ccc1N |
| InChI | InChI=1S/C11H17BrN2/c1-3-8(2)7-14-11-6-9(12)4-5-10(11)13/h4-6,8,14H,3,7,13H2,1-2H3 |
| InChIKey | DZXFONWKPCFRER-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.17 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|