About (E)-1,2,3-triphenylprop-2-en-1-ol
(E)-1,2,3-triphenylprop-2-en-1-ol (PubChem CID 6534349) has the molecular formula C21H18O
and a molecular weight of 286.37 g/mol. Its IUPAC name is (E)-1,2,3-triphenylprop-2-en-1-ol.
Molecular Properties
| Compound Name | (E)-1,2,3-triphenylprop-2-en-1-ol |
| PubChem CID | 6534349 |
| Molecular Formula | C21H18O |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | (E)-1,2,3-triphenylprop-2-en-1-ol |
| SMILES | OC(/C(=C/c1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H18O/c22-21(19-14-8-3-9-15-19)20(18-12-6-2-7-13-18)16-17-10-4-1-5-11-17/h1-16,21-22H/b20-16+ |
| InChIKey | QMCPCLHQCXJHSB-CAPFRKAQSA-N |
| XLogP | 4.96 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze (E)-1,2,3-triphenylprop-2-en-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-1,2,3-triphenylprop-2-en-1-ol?
The IUPAC name of (E)-1,2,3-triphenylprop-2-en-1-ol (CID 6534349) is (E)-1,2,3-triphenylprop-2-en-1-ol.
What is the SMILES notation for (E)-1,2,3-triphenylprop-2-en-1-ol?
The canonical SMILES for (E)-1,2,3-triphenylprop-2-en-1-ol is OC(/C(=C/c1ccccc1)c1ccccc1)c1ccccc1.
What is the InChIKey of (E)-1,2,3-triphenylprop-2-en-1-ol?
The InChIKey is QMCPCLHQCXJHSB-CAPFRKAQSA-N. The full InChI is InChI=1S/C21H18O/c22-21(19-14-8-3-9-15-19)20(18-12-6-2-7-13-18)16-17-10-4-1-5-11-17/h1-16,21-22H/b20-16+.
What are the key properties of (E)-1,2,3-triphenylprop-2-en-1-ol?
(E)-1,2,3-triphenylprop-2-en-1-ol has a molecular weight of 286.37 g/mol, XLogP of 4.96, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-1,2,3-triphenylprop-2-en-1-ol is sourced from PubChem (CID 6534349), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).