C13H18BrN3O2 — CID 65343726
N-(5-bromo-2-nitrophenyl)-N-ethylpiperidin-3-amine (PubChem CID 65343726) has the molecular formula C13H18BrN3O2 and a molecular weight of 328.21 g/mol. Its IUPAC name is N-(5-bromo-2-nitrophenyl)-N-ethylpiperidin-3-amine.
| Compound Name | N-(5-bromo-2-nitrophenyl)-N-ethylpiperidin-3-amine |
|---|---|
| PubChem CID | 65343726 |
| Molecular Formula | C13H18BrN3O2 |
| Molecular Weight | 328.21 g/mol |
| Exact Mass | 327.06 |
| IUPAC Name | N-(5-bromo-2-nitrophenyl)-N-ethylpiperidin-3-amine |
| SMILES | CCN(c1cc(Br)ccc1[N+](=O)[O-])C1CCCNC1 |
| InChI | InChI=1S/C13H18BrN3O2/c1-2-16(11-4-3-7-15-9-11)13-8-10(14)5-6-12(13)17(18)19/h5-6,8,11,15H,2-4,7,9H2,1H3 |
| InChIKey | BIECDIRVBYQBPR-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 58.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.21 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|