C17H24N2O — CID 65343972
2-methoxy-5-[[methyl-(4-methylcyclohexyl)amino]methyl]benzonitrile (PubChem CID 65343972) has the molecular formula C17H24N2O and a molecular weight of 272.39 g/mol. Its IUPAC name is 2-methoxy-5-[[methyl-(4-methylcyclohexyl)amino]methyl]benzonitrile.
| Compound Name | 2-methoxy-5-[[methyl-(4-methylcyclohexyl)amino]methyl]benzonitrile |
|---|---|
| PubChem CID | 65343972 |
| Molecular Formula | C17H24N2O |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.19 |
| IUPAC Name | 2-methoxy-5-[[methyl-(4-methylcyclohexyl)amino]methyl]benzonitrile |
| SMILES | COc1ccc(CN(C)C2CCC(C)CC2)cc1C#N |
| InChI | InChI=1S/C17H24N2O/c1-13-4-7-16(8-5-13)19(2)12-14-6-9-17(20-3)15(10-14)11-18/h6,9-10,13,16H,4-5,7-8,12H2,1-3H3 |
| InChIKey | DSPPVUUIKCNVTQ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 36.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |