C14H16BrClN2 — CID 65346626
6-bromo-2-(chloromethyl)-1-(1-methylcyclopentyl)benzimidazole (PubChem CID 65346626) has the molecular formula C14H16BrClN2 and a molecular weight of 327.65 g/mol. Its IUPAC name is 6-bromo-2-(chloromethyl)-1-(1-methylcyclopentyl)benzimidazole.
| Compound Name | 6-bromo-2-(chloromethyl)-1-(1-methylcyclopentyl)benzimidazole |
|---|---|
| PubChem CID | 65346626 |
| Molecular Formula | C14H16BrClN2 |
| Molecular Weight | 327.65 g/mol |
| Exact Mass | 326.02 |
| IUPAC Name | 6-bromo-2-(chloromethyl)-1-(1-methylcyclopentyl)benzimidazole |
| SMILES | CC1(n2c(CCl)nc3ccc(Br)cc32)CCCC1 |
| InChI | InChI=1S/C14H16BrClN2/c1-14(6-2-3-7-14)18-12-8-10(15)4-5-11(12)17-13(18)9-16/h4-5,8H,2-3,6-7,9H2,1H3 |
| InChIKey | HBIJZWNXYUYLRH-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.65 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|