C17H28N2 — CID 65348196
3-[2-(4-propylazepan-1-yl)ethyl]aniline (PubChem CID 65348196) has the molecular formula C17H28N2 and a molecular weight of 260.42 g/mol. Its IUPAC name is 3-[2-(4-propylazepan-1-yl)ethyl]aniline.
| Compound Name | 3-[2-(4-propylazepan-1-yl)ethyl]aniline |
|---|---|
| PubChem CID | 65348196 |
| Molecular Formula | C17H28N2 |
| Molecular Weight | 260.42 g/mol |
| Exact Mass | 260.23 |
| IUPAC Name | 3-[2-(4-propylazepan-1-yl)ethyl]aniline |
| SMILES | CCCC1CCCN(CCc2cccc(N)c2)CC1 |
| InChI | InChI=1S/C17H28N2/c1-2-5-15-7-4-11-19(12-9-15)13-10-16-6-3-8-17(18)14-16/h3,6,8,14-15H,2,4-5,7,9-13,18H2,1H3 |
| InChIKey | TUICWXAWEWAYGH-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.42 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|