C13H11BrN4 — CID 65349371
4-[(6-bromo-[1,2,4]triazolo[4,3-a]pyridin-3-yl)methyl]aniline (PubChem CID 65349371) has the molecular formula C13H11BrN4 and a molecular weight of 303.16 g/mol. Its IUPAC name is 4-[(6-bromo-[1,2,4]triazolo[4,3-a]pyridin-3-yl)methyl]aniline.
| Compound Name | 4-[(6-bromo-[1,2,4]triazolo[4,3-a]pyridin-3-yl)methyl]aniline |
|---|---|
| PubChem CID | 65349371 |
| Molecular Formula | C13H11BrN4 |
| Molecular Weight | 303.16 g/mol |
| Exact Mass | 302.02 |
| IUPAC Name | 4-[(6-bromo-[1,2,4]triazolo[4,3-a]pyridin-3-yl)methyl]aniline |
| SMILES | Nc1ccc(Cc2nnc3ccc(Br)cn23)cc1 |
| InChI | InChI=1S/C13H11BrN4/c14-10-3-6-12-16-17-13(18(12)8-10)7-9-1-4-11(15)5-2-9/h1-6,8H,7,15H2 |
| InChIKey | YQGJQDDYAIWDTR-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 56.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.16 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|