About N'-hydroxydodecanimidamide
N'-hydroxydodecanimidamide (PubChem CID 6534948) has the molecular formula C12H26N2O
and a molecular weight of 214.35 g/mol. Its IUPAC name is N'-hydroxydodecanimidamide.
Molecular Properties
| Compound Name | N'-hydroxydodecanimidamide |
| PubChem CID | 6534948 |
| Molecular Formula | C12H26N2O |
| Molecular Weight | 214.35 g/mol |
| Exact Mass | 214.20 |
| IUPAC Name | N'-hydroxydodecanimidamide |
| SMILES | CCCCCCCCCCC/C(N)=N/O |
| InChI | InChI=1S/C12H26N2O/c1-2-3-4-5-6-7-8-9-10-11-12(13)14-15/h15H,2-11H2,1H3,(H2,13,14) |
| InChIKey | KVACUYQANHDHQF-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 58.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.35 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-hydroxydodecanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-hydroxydodecanimidamide?
The IUPAC name of N'-hydroxydodecanimidamide (CID 6534948) is N'-hydroxydodecanimidamide.
What is the SMILES notation for N'-hydroxydodecanimidamide?
The canonical SMILES for N'-hydroxydodecanimidamide is CCCCCCCCCCC/C(N)=N/O.
What is the InChIKey of N'-hydroxydodecanimidamide?
The InChIKey is KVACUYQANHDHQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H26N2O/c1-2-3-4-5-6-7-8-9-10-11-12(13)14-15/h15H,2-11H2,1H3,(H2,13,14).
What are the key properties of N'-hydroxydodecanimidamide?
N'-hydroxydodecanimidamide has a molecular weight of 214.35 g/mol, XLogP of 3.65, 10 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-hydroxydodecanimidamide is sourced from PubChem (CID 6534948), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).