C13H20N2S — CID 65350362
N-[2-(3-aminophenyl)ethyl]-N-methylthiolan-3-amine (PubChem CID 65350362) has the molecular formula C13H20N2S and a molecular weight of 236.38 g/mol. Its IUPAC name is N-[2-(3-aminophenyl)ethyl]-N-methylthiolan-3-amine.
| Compound Name | N-[2-(3-aminophenyl)ethyl]-N-methylthiolan-3-amine |
|---|---|
| PubChem CID | 65350362 |
| Molecular Formula | C13H20N2S |
| Molecular Weight | 236.38 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | N-[2-(3-aminophenyl)ethyl]-N-methylthiolan-3-amine |
| SMILES | CN(CCc1cccc(N)c1)C1CCSC1 |
| InChI | InChI=1S/C13H20N2S/c1-15(13-6-8-16-10-13)7-5-11-3-2-4-12(14)9-11/h2-4,9,13H,5-8,10,14H2,1H3 |
| InChIKey | WCGAEHCBJWZQQG-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.38 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|