About 2-(1-cyclopentylpyrazol-3-yl)-1-(1,4-dioxan-2-yl)ethanol
2-(1-cyclopentylpyrazol-3-yl)-1-(1,4-dioxan-2-yl)ethanol (PubChem CID 65350601) has the molecular formula C14H22N2O3
and a molecular weight of 266.34 g/mol. Its IUPAC name is 2-(1-cyclopentylpyrazol-3-yl)-1-(1,4-dioxan-2-yl)ethanol.
Molecular Properties
| Compound Name | 2-(1-cyclopentylpyrazol-3-yl)-1-(1,4-dioxan-2-yl)ethanol |
| PubChem CID | 65350601 |
| Molecular Formula | C14H22N2O3 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.16 |
| IUPAC Name | 2-(1-cyclopentylpyrazol-3-yl)-1-(1,4-dioxan-2-yl)ethanol |
| SMILES | OC(Cc1ccn(C2CCCC2)n1)C1COCCO1 |
| InChI | InChI=1S/C14H22N2O3/c17-13(14-10-18-7-8-19-14)9-11-5-6-16(15-11)12-3-1-2-4-12/h5-6,12-14,17H,1-4,7-10H2 |
| InChIKey | UUCSZWICBFEATQ-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(1-cyclopentylpyrazol-3-yl)-1-(1,4-dioxan-2-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-cyclopentylpyrazol-3-yl)-1-(1,4-dioxan-2-yl)ethanol?
The IUPAC name of 2-(1-cyclopentylpyrazol-3-yl)-1-(1,4-dioxan-2-yl)ethanol (CID 65350601) is 2-(1-cyclopentylpyrazol-3-yl)-1-(1,4-dioxan-2-yl)ethanol.
What is the SMILES notation for 2-(1-cyclopentylpyrazol-3-yl)-1-(1,4-dioxan-2-yl)ethanol?
The canonical SMILES for 2-(1-cyclopentylpyrazol-3-yl)-1-(1,4-dioxan-2-yl)ethanol is OC(Cc1ccn(C2CCCC2)n1)C1COCCO1.
What is the InChIKey of 2-(1-cyclopentylpyrazol-3-yl)-1-(1,4-dioxan-2-yl)ethanol?
The InChIKey is UUCSZWICBFEATQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22N2O3/c17-13(14-10-18-7-8-19-14)9-11-5-6-16(15-11)12-3-1-2-4-12/h5-6,12-14,17H,1-4,7-10H2.
What are the key properties of 2-(1-cyclopentylpyrazol-3-yl)-1-(1,4-dioxan-2-yl)ethanol?
2-(1-cyclopentylpyrazol-3-yl)-1-(1,4-dioxan-2-yl)ethanol has a molecular weight of 266.34 g/mol, XLogP of 1.32, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-cyclopentylpyrazol-3-yl)-1-(1,4-dioxan-2-yl)ethanol is sourced from PubChem (CID 65350601), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).