About 2-(1-butan-2-ylpyrazol-3-yl)-1-(1,4-dioxan-2-yl)ethanol
2-(1-butan-2-ylpyrazol-3-yl)-1-(1,4-dioxan-2-yl)ethanol (PubChem CID 65350651) has the molecular formula C13H22N2O3
and a molecular weight of 254.33 g/mol. Its IUPAC name is 2-(1-butan-2-ylpyrazol-3-yl)-1-(1,4-dioxan-2-yl)ethanol.
Molecular Properties
| Compound Name | 2-(1-butan-2-ylpyrazol-3-yl)-1-(1,4-dioxan-2-yl)ethanol |
| PubChem CID | 65350651 |
| Molecular Formula | C13H22N2O3 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.16 |
| IUPAC Name | 2-(1-butan-2-ylpyrazol-3-yl)-1-(1,4-dioxan-2-yl)ethanol |
| SMILES | CCC(C)n1ccc(CC(O)C2COCCO2)n1 |
| InChI | InChI=1S/C13H22N2O3/c1-3-10(2)15-5-4-11(14-15)8-12(16)13-9-17-6-7-18-13/h4-5,10,12-13,16H,3,6-9H2,1-2H3 |
| InChIKey | XEKGYELCWWJOSS-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(1-butan-2-ylpyrazol-3-yl)-1-(1,4-dioxan-2-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-butan-2-ylpyrazol-3-yl)-1-(1,4-dioxan-2-yl)ethanol?
The IUPAC name of 2-(1-butan-2-ylpyrazol-3-yl)-1-(1,4-dioxan-2-yl)ethanol (CID 65350651) is 2-(1-butan-2-ylpyrazol-3-yl)-1-(1,4-dioxan-2-yl)ethanol.
What is the SMILES notation for 2-(1-butan-2-ylpyrazol-3-yl)-1-(1,4-dioxan-2-yl)ethanol?
The canonical SMILES for 2-(1-butan-2-ylpyrazol-3-yl)-1-(1,4-dioxan-2-yl)ethanol is CCC(C)n1ccc(CC(O)C2COCCO2)n1.
What is the InChIKey of 2-(1-butan-2-ylpyrazol-3-yl)-1-(1,4-dioxan-2-yl)ethanol?
The InChIKey is XEKGYELCWWJOSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22N2O3/c1-3-10(2)15-5-4-11(14-15)8-12(16)13-9-17-6-7-18-13/h4-5,10,12-13,16H,3,6-9H2,1-2H3.
What are the key properties of 2-(1-butan-2-ylpyrazol-3-yl)-1-(1,4-dioxan-2-yl)ethanol?
2-(1-butan-2-ylpyrazol-3-yl)-1-(1,4-dioxan-2-yl)ethanol has a molecular weight of 254.33 g/mol, XLogP of 1.17, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-butan-2-ylpyrazol-3-yl)-1-(1,4-dioxan-2-yl)ethanol is sourced from PubChem (CID 65350651), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).