About 2-cyclopropyl-1-(1,4-dioxan-2-yl)ethanol
2-cyclopropyl-1-(1,4-dioxan-2-yl)ethanol (PubChem CID 65350652) has the molecular formula C9H16O3
and a molecular weight of 172.22 g/mol. Its IUPAC name is 2-cyclopropyl-1-(1,4-dioxan-2-yl)ethanol.
Molecular Properties
| Compound Name | 2-cyclopropyl-1-(1,4-dioxan-2-yl)ethanol |
| PubChem CID | 65350652 |
| Molecular Formula | C9H16O3 |
| Molecular Weight | 172.22 g/mol |
| Exact Mass | 172.11 |
| IUPAC Name | 2-cyclopropyl-1-(1,4-dioxan-2-yl)ethanol |
| SMILES | OC(CC1CC1)C1COCCO1 |
| InChI | InChI=1S/C9H16O3/c10-8(5-7-1-2-7)9-6-11-3-4-12-9/h7-10H,1-6H2 |
| InChIKey | QSPUUCLCJWLCMS-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.22 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-cyclopropyl-1-(1,4-dioxan-2-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclopropyl-1-(1,4-dioxan-2-yl)ethanol?
The IUPAC name of 2-cyclopropyl-1-(1,4-dioxan-2-yl)ethanol (CID 65350652) is 2-cyclopropyl-1-(1,4-dioxan-2-yl)ethanol.
What is the SMILES notation for 2-cyclopropyl-1-(1,4-dioxan-2-yl)ethanol?
The canonical SMILES for 2-cyclopropyl-1-(1,4-dioxan-2-yl)ethanol is OC(CC1CC1)C1COCCO1.
What is the InChIKey of 2-cyclopropyl-1-(1,4-dioxan-2-yl)ethanol?
The InChIKey is QSPUUCLCJWLCMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16O3/c10-8(5-7-1-2-7)9-6-11-3-4-12-9/h7-10H,1-6H2.
What are the key properties of 2-cyclopropyl-1-(1,4-dioxan-2-yl)ethanol?
2-cyclopropyl-1-(1,4-dioxan-2-yl)ethanol has a molecular weight of 172.22 g/mol, XLogP of 0.56, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopropyl-1-(1,4-dioxan-2-yl)ethanol is sourced from PubChem (CID 65350652), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).