C15H11F3O3 — CID 65350657
2,3-dihydro-1,4-benzodioxin-3-yl-(2,3,4-trifluorophenyl)methanol (PubChem CID 65350657) has the molecular formula C15H11F3O3 and a molecular weight of 296.24 g/mol. Its IUPAC name is 2,3-dihydro-1,4-benzodioxin-3-yl-(2,3,4-trifluorophenyl)methanol.
| Compound Name | 2,3-dihydro-1,4-benzodioxin-3-yl-(2,3,4-trifluorophenyl)methanol |
|---|---|
| PubChem CID | 65350657 |
| Molecular Formula | C15H11F3O3 |
| Molecular Weight | 296.24 g/mol |
| Exact Mass | 296.07 |
| IUPAC Name | 2,3-dihydro-1,4-benzodioxin-3-yl-(2,3,4-trifluorophenyl)methanol |
| SMILES | OC(c1ccc(F)c(F)c1F)C1COc2ccccc2O1 |
| InChI | InChI=1S/C15H11F3O3/c16-9-6-5-8(13(17)14(9)18)15(19)12-7-20-10-3-1-2-4-11(10)21-12/h1-6,12,15,19H,7H2 |
| InChIKey | FFNKJVRLLDYHQN-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.24 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|