C13H10N2O3 — CID 65351120
2,3-dihydro-1,4-benzodioxin-3-yl(pyrazin-2-yl)methanone (PubChem CID 65351120) has the molecular formula C13H10N2O3 and a molecular weight of 242.23 g/mol. Its IUPAC name is 2,3-dihydro-1,4-benzodioxin-3-yl(pyrazin-2-yl)methanone.
| Compound Name | 2,3-dihydro-1,4-benzodioxin-3-yl(pyrazin-2-yl)methanone |
|---|---|
| PubChem CID | 65351120 |
| Molecular Formula | C13H10N2O3 |
| Molecular Weight | 242.23 g/mol |
| Exact Mass | 242.07 |
| IUPAC Name | 2,3-dihydro-1,4-benzodioxin-3-yl(pyrazin-2-yl)methanone |
| SMILES | O=C(c1cnccn1)C1COc2ccccc2O1 |
| InChI | InChI=1S/C13H10N2O3/c16-13(9-7-14-5-6-15-9)12-8-17-10-3-1-2-4-11(10)18-12/h1-7,12H,8H2 |
| InChIKey | AUZALVOPNJXVIW-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.23 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |