About 5-[2-(1,4-dioxan-2-yl)-1,3-thiazol-4-yl]thiophene-3-carboxylic acid
5-[2-(1,4-dioxan-2-yl)-1,3-thiazol-4-yl]thiophene-3-carboxylic acid (PubChem CID 65351313) has the molecular formula C12H11NO4S2
and a molecular weight of 297.36 g/mol. Its IUPAC name is 5-[2-(1,4-dioxan-2-yl)-1,3-thiazol-4-yl]thiophene-3-carboxylic acid.
Molecular Properties
| Compound Name | 5-[2-(1,4-dioxan-2-yl)-1,3-thiazol-4-yl]thiophene-3-carboxylic acid |
| PubChem CID | 65351313 |
| Molecular Formula | C12H11NO4S2 |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.01 |
| IUPAC Name | 5-[2-(1,4-dioxan-2-yl)-1,3-thiazol-4-yl]thiophene-3-carboxylic acid |
| SMILES | O=C(O)c1csc(-c2csc(C3COCCO3)n2)c1 |
| InChI | InChI=1S/C12H11NO4S2/c14-12(15)7-3-10(18-5-7)8-6-19-11(13-8)9-4-16-1-2-17-9/h3,5-6,9H,1-2,4H2,(H,14,15) |
| InChIKey | LOZOYVOOGBYFGA-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-[2-(1,4-dioxan-2-yl)-1,3-thiazol-4-yl]thiophene-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[2-(1,4-dioxan-2-yl)-1,3-thiazol-4-yl]thiophene-3-carboxylic acid?
The IUPAC name of 5-[2-(1,4-dioxan-2-yl)-1,3-thiazol-4-yl]thiophene-3-carboxylic acid (CID 65351313) is 5-[2-(1,4-dioxan-2-yl)-1,3-thiazol-4-yl]thiophene-3-carboxylic acid.
What is the SMILES notation for 5-[2-(1,4-dioxan-2-yl)-1,3-thiazol-4-yl]thiophene-3-carboxylic acid?
The canonical SMILES for 5-[2-(1,4-dioxan-2-yl)-1,3-thiazol-4-yl]thiophene-3-carboxylic acid is O=C(O)c1csc(-c2csc(C3COCCO3)n2)c1.
What is the InChIKey of 5-[2-(1,4-dioxan-2-yl)-1,3-thiazol-4-yl]thiophene-3-carboxylic acid?
The InChIKey is LOZOYVOOGBYFGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11NO4S2/c14-12(15)7-3-10(18-5-7)8-6-19-11(13-8)9-4-16-1-2-17-9/h3,5-6,9H,1-2,4H2,(H,14,15).
What are the key properties of 5-[2-(1,4-dioxan-2-yl)-1,3-thiazol-4-yl]thiophene-3-carboxylic acid?
5-[2-(1,4-dioxan-2-yl)-1,3-thiazol-4-yl]thiophene-3-carboxylic acid has a molecular weight of 297.36 g/mol, XLogP of 2.66, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[2-(1,4-dioxan-2-yl)-1,3-thiazol-4-yl]thiophene-3-carboxylic acid is sourced from PubChem (CID 65351313), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).