C13H16N2O3 — CID 65351501
2,3-dihydro-1,4-benzodioxin-3-yl(morpholin-4-yl)methanimine (PubChem CID 65351501) has the molecular formula C13H16N2O3 and a molecular weight of 248.28 g/mol. Its IUPAC name is 2,3-dihydro-1,4-benzodioxin-3-yl(morpholin-4-yl)methanimine.
| Compound Name | 2,3-dihydro-1,4-benzodioxin-3-yl(morpholin-4-yl)methanimine |
|---|---|
| PubChem CID | 65351501 |
| Molecular Formula | C13H16N2O3 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | 2,3-dihydro-1,4-benzodioxin-3-yl(morpholin-4-yl)methanimine |
| SMILES | [H]/N=C(/C1COc2ccccc2O1)N1CCOCC1 |
| InChI | InChI=1S/C13H16N2O3/c14-13(15-5-7-16-8-6-15)12-9-17-10-3-1-2-4-11(10)18-12/h1-4,12,14H,5-9H2/b14-13- |
| InChIKey | HLRNKILJKXPTKP-YPKPFQOOSA-N |
| XLogP | 1.14 |
| TPSA | 54.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|